Topics in Applied Physics Volume126 TopicsinAppliedPhysicsispartoftheSpringerLinkservice.Forallcustomerswithstanding ordersforTopicsinAppliedPhysicsweofferthefulltextinelectronicformviaSpringerLink freeofcharge.Pleasecontactyourlibrarianwhocanreceiveapasswordforfreeaccesstothe fullarticlesbyregistrationat: springerlink.com→Orders Ifyoudonothaveastandingorderyoucanneverthelessbrowsethroughthetableofcontents ofthevolumesandtheabstractsofeacharticleat: springerlink.com→BrowsePublications Forfurthervolumes: www.springer.com/series/560 TopicsinAppliedPhysicsisawell-establishedseriesofreviewbooks,eachofwhichpresents acomprehensivesurveyofaselectedtopicwithinthebroadareaofappliedphysics.Edited andwrittenbyleadingresearchscientistsinthefieldconcerned,eachvolumecontainsreview contributionscoveringthevariousaspectsofthetopic.Togethertheseprovideanoverviewof thestateoftheartintherespectivefield,extendingfromanintroductiontothesubjectright uptothefrontiersofcontemporaryresearch. Topics in Applied Physics is addressed to all scientists at universities and in industry who wishto obtain anoverviewandto keep abreastofadvances inapplied physics.The series alsoprovideseasybutcomprehensiveaccesstothefieldsfornewcomersstartingresearch. Contributionsarespeciallycommissioned.TheManagingEditorsareopentoanysuggestions for topics coming from the community of applied physicists no matter what the field and encourageprospectiveeditorstoapproachthemwithideas. ManagingEditor Dr.ClausE.Ascheron Springer-VerlagGmbH Tiergartenstr.17 69121Heidelberg Germany [email protected] AssistantEditor AdelheidH.Duhm Springer-VerlagGmbH Tiergartenstr.17 69121Heidelberg Germany [email protected] Tae-Yeon Seong (cid:2) Jung Han (cid:2) Hiroshi Amano (cid:2) Hadis Morkoç Editors III-Nitride Based Light Emitting Diodes and Applications Editors Tae-YeonSeong HiroshiAmano DepartmentofMaterialsScience DepartmentofElectricalEngineering andEngineering andComputerScience KoreaUniversity NagoyaUniversity Seoul,RepublicofKorea Nagoya,Aichi,Japan JungHan HadisMorkoç DepartmentofElectricalEngineering DepartmentofElectricalandComputer YaleUniversity EngineeringandPhysics NewHaven,CT,USA VirginiaCommonwealthUniversity Richmond,VA,USA ISSN0303-4216 ISSN1437-0859(electronic) TopicsinAppliedPhysics ISBN978-94-007-5862-9 ISBN978-94-007-5863-6(eBook) DOI10.1007/978-94-007-5863-6 SpringerDordrechtHeidelbergNewYorkLondon LibraryofCongressControlNumber:2013938735 ©SpringerScience+BusinessMediaDordrecht2013 Thisworkissubjecttocopyright.AllrightsarereservedbythePublisher,whetherthewholeorpartof thematerialisconcerned,specificallytherightsoftranslation,reprinting,reuseofillustrations,recitation, broadcasting,reproductiononmicrofilmsorinanyotherphysicalway,andtransmissionorinformation storageandretrieval,electronicadaptation,computersoftware,orbysimilarordissimilarmethodology nowknownorhereafterdeveloped.Exemptedfromthislegalreservationarebriefexcerptsinconnection with reviews or scholarly analysis or material supplied specifically for the purpose of being entered and executed on a computer system, for exclusive use by the purchaser of the work. Duplication of this publication or parts thereof is permitted only under the provisions of the Copyright Law of the Publisher’slocation,initscurrentversion,andpermissionforusemustalwaysbeobtainedfromSpringer. PermissionsforusemaybeobtainedthroughRightsLinkattheCopyrightClearanceCenter.Violations areliabletoprosecutionundertherespectiveCopyrightLaw. Theuseofgeneraldescriptivenames,registerednames,trademarks,servicemarks,etc.inthispublication doesnotimply,evenintheabsenceofaspecificstatement,thatsuchnamesareexemptfromtherelevant protectivelawsandregulationsandthereforefreeforgeneraluse. Whiletheadviceandinformationinthisbookarebelievedtobetrueandaccurateatthedateofpub- lication,neithertheauthorsnortheeditorsnorthepublishercanacceptanylegalresponsibilityforany errorsoromissionsthatmaybemade.Thepublishermakesnowarranty,expressorimplied,withrespect tothematerialcontainedherein. Printedonacid-freepaper SpringerispartofSpringerScience+BusinessMedia(www.springer.com) Preface Overthelasttwodecades,significantprogresshasbeenmadeinthegrowth,doping and processing technologies of III-nitride based semiconductors which paved the wayforhighbrightnesslightemittingdiodes(LEDs).LEDshavealreadypenetrated trafficsignals,signagelighting,andautomotiveapplications.However,itsultimate goal is to replace traditional lamps, such as incandescent and fluorescent varieties fuelledbythefactthatLEDlightingsubstantiallyreducesenergyconsumptionand thusthecarbonfootprint.DespitebreathtakingadvancesinLEDtechnologies(e.g., growth, doping and processing technologies), there remain critical issues for fur- ther improvement for the realization of LED lighting. Considering that there are alreadyseveralbooksdealingwithknownandbasicissuesinIII-nitride-basedop- toelectronicdevicesincludingLEDsandlaserdiodes,thisbookaimstoprovidethe readerswithcontemporaryLEDissueswhichhavenotbeencomprehensivelydis- cussedandonwhichtheperformanceofLEDsiscriticallydependent.Forexample, mostimportantly,theremustbeabreakthroughinthegrowthofhigh-qualitynitride semiconductorepitaxiallayerswithlowdislocationdensity,inparticular,forAl-rich and In-rich varieties. The materials quality is directly dependent on the substrates used, such as sapphire, Si, etc. In addition, the loss in efficiency at high injection levels, growth on different orientations (giving rise to polar, semi-polar and non- polarmaterial),andpolarizationarealsoimportant.Chipprocessingandpackaging technologiesarekeyissuesaswell. Chapter1chroniclesthelow-temperature-depositedbufferlayersandtheimpact theyhadonnitrideresearchandthesubsequentdevelopmentofdevices.Chapter2 deals with a perspective on the future of LED efficiency. Chapter3 reviews the development of GaN epitaxial growth on Si using different methods and nitride LEDperformanceonSi.Chapter4presentsthepropertiesandthefabricationpro- cesses associated with patterned sapphire substrate (PSS) and applications of this technologytogrowthofnon-polarandsemi-polarGaNlayers.Chapter5provides an overview of epitaxial growth and optical properties of IIInitride LEDs on non- and semi-polar orientations. Chapter6 presents different techniques utilized to as- sesstheinternalquantumefficiency(IQE)inLEDs.Chapter7reviewstheIQEloss mechanisms.Chapter8describeselectricalproperties,reliability,andelectro-static v vi Preface discharge robustness of InGaN-based LEDs. Chapter9 treats simulations of light extraction efficiency (LEE) as a function of the major materials parameters and geometries in the mainstream LED structures. Chapter10 deals with fabrication methodologies for high efficiency LEDs for relatively high LEE. Chapter11 pro- videsanoverviewofphosphorsandLEDpackagingconfigurationsforwhilelight emission. Chapter12 discusses the optoelectrical characteristics, various designs, and developments of high voltage and alternating current (AC) LEDs. Chapter13 givesanoverviewofthefundamentalsofchromaticityandcolorrendering,thetwo importantaspectsofcolorqualityforgenerallighting.Chapter14describespossi- blefuturesystemlevelapplicationsofLEDsfromtheviewpointofemergingtrends inlightingrelatedtohumanhealth,communication,anddisplaytechnologies. Seoul,Korea Tae-YeonSeong NewHaven,USA JungHan Nagoya,Japan HiroshiAmano Richmond,USA HadisMorkoç Contents 1 Introduction Part A. Progress and Prospect of Growth ofWide-Band-GapIII-Nitrides . . . . . . . . . . . . . . . . . . . . . 1 HiroshiAmano 1.1 HistoryofIII–VResearch(1950sto1970s) . . . . . . . . . . . . . 1 1.2 DawnofGaNResearch(1970stoMid1980s) . . . . . . . . . . . 3 1.3 Low-Temperature-DepositedBuffer Layer, p-TypeGaNand HighlyLuminescentInGaN(Late1980s) . . . . . . . . . . . . . . 4 1.4 Summary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8 2 IntroductionPartB.Ultra-efficientSolid-StateLighting:Likely Characteristics,EconomicBenefits,TechnologicalApproaches . . . 11 JeffY.Tsao, JonathanJ.WiererJr., LaurenE.S.Rohwer, MichaelE.Coltrin, MaryH.Crawford, JerryA.Simmons, Po-ChiehHung, HarrySaunders, DmitryS.Sizov, RajBhat, and Chung-EnZah 2.1 SomeLikelyCharacteristicsofUltra(>70%)EfficientSSL . . . . 12 2.2 TheUltimateSSLSourceIsSpiky . . . . . . . . . . . . . . . . . 14 2.2.1 SpikySpectraGiveGoodCRI . . . . . . . . . . . . . . . . 14 2.2.2 SpikySpectraGivetheHighestMWLERs . . . . . . . . . 15 2.3 EconomicBenefitsofUltra-efficientSSL . . . . . . . . . . . . . . 17 2.3.1 Scenario1:LightIsNotaFactorofProduction . . . . . . . 17 2.3.2 Scenario2:LightIsaFactorofProduction . . . . . . . . . 18 2.3.3 A Qualified Nod to Scenario 2: MoreLight=MoreProductivity . . . . . . . . . . . . . . 19 2.4 TwoCompetingApproaches:LowandHighPowerDensities . . . 20 2.4.1 LowPowerDensityApproach(LEDs) . . . . . . . . . . . 21 2.4.2 HighPower-DensityApproach . . . . . . . . . . . . . . . 23 2.5 Summary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 24 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 25 vii viii Contents 3 EpitaxyPartA.LEDsBasedonHeteroepitaxialGaNonSiSubstrates 27 TakashiEgawaandOsamuOda 3.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 3.2 EpitaxialGrowthandCharacterization . . . . . . . . . . . . . . . 30 3.2.1 GaNGrowthonSapphire . . . . . . . . . . . . . . . . . . 30 3.2.2 GaNGrowthonSiC . . . . . . . . . . . . . . . . . . . . . 36 3.2.3 GaN/SiUsingLowTemperature(LT)IntermediateLayers . 36 3.2.4 GaN/Si Using High Temperature (HT) AlN/AlGaNIntermediateLayers . . . . . . . . . . . . . . 37 3.2.5 GaN/Si Using HT Intermediate Layers (ILs) and Multilayers(MLs) . . . . . . . . . . . . . . . . . . . . . . 38 3.2.6 GaN/SiUsingSLSInterlayers . . . . . . . . . . . . . . . . 39 3.3 FabricationofLEDsandTheirPerformances . . . . . . . . . . . . 43 3.3.1 Device Characteristics of LED Structures withHTAlN/AlGaNIntermediateLayers[62–66] . . . . . 43 3.3.2 Effect of Thin AlN Intermediate Layers andAlN/GaNMLs[35,71–78] . . . . . . . . . . . . . . . 44 3.3.3 WaferBondingandLift-Off[79] . . . . . . . . . . . . . . 47 3.3.4 EffectoftheInsertionofSLSLayers[97–99] . . . . . . . 50 3.3.5 OtherStructures . . . . . . . . . . . . . . . . . . . . . . . 51 3.4 Conclusion . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54 4 EpitaxyPartB.EpitaxialGrowthofGaNonPatternedSapphire Substrates . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 59 KazuyukiTadatomo 4.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 59 4.2 PropertiesandFabricationofPSSs . . . . . . . . . . . . . . . . . 60 4.3 GrowthofGaNonPSS,andPropertiesofGaN-LEDsonPSS . . . 62 4.3.1 SAGandELO . . . . . . . . . . . . . . . . . . . . . . . . 62 4.3.2 GaNGrowthonPSSandtheMechanismofDecreasing DislocationDensitybyELO. . . . . . . . . . . . . . . . . 65 4.3.3 CharacteristicsofLEDsGrownonPSS . . . . . . . . . . . 67 4.4 The Principle of Light Extraction Efficiency Improvement ofGaN-BasedLEDsbyPatternedSapphireSubstrate . . . . . . . 68 4.4.1 Impact of Surface Structure of LEDs on Light ExtractionEfficiencyImprovement . . . . . . . . . . . . . 68 4.4.2 ThePrincipleofLightExtractionEfficiencyImprovement ofGaN-BasedLEDsbyPatternedSapphireSubstrate . . . 69 4.4.3 DevelopmentofPSSwithMicrometer-SizedStructures . . 70 4.4.4 DevelopmentofPSSwithSub-micrometer-SizedStructures 72 4.5 NovelApplicationofPSStoGrowthofNonpolarorSemipolarGaN 75 4.6 Summary . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 77 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 78 Contents ix 5 GrowthandOpticalPropertiesofGaN-BasedNon-andSemipolar LEDs . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 83 MichaelKneissl,JensRass,LukasSchade,andUlrichT.Schwarz 5.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 5.2 PiezoelectricandSpontaneousPolarizationinGroup-IIINitrides . 84 5.3 GrowthofGaNandInGaNonDifferentNon-andSemipolar SurfaceOrientations . . . . . . . . . . . . . . . . . . . . . . . . . 88 5.3.1 HeteroepitaxialGrowth of Non- and Semipolar GaN onSapphire,Silicon,Spinel,andLiAlO Substrates . . . . 89 2 5.3.2 Surface Morphologies and Strutural Defects of Non- andSemipolarGaNFilms . . . . . . . . . . . . . . . . . . 91 5.3.3 IndiumIncorporationinInGaNLayersandQuantum WellsonDifferentSemipolarandNonpolarSurfaces. . . . 94 5.4 Polarization of the Light Emission from Non- and SemipolarInGaNQWs . . . . . . . . . . . . . . . . . . . . . . . 95 5.4.1 LightEmissionfromNonpolarInGaNQWs . . . . . . . . 98 5.4.2 LightEmissionfromSemipolarInGaNQWs . . . . . . . . 99 5.5 PerformanceCharacteristicsofNon-andSemipolarInGaNQW LightEmittingDiodes . . . . . . . . . . . . . . . . . . . . . . . . 105 5.5.1 WavelengthShift. . . . . . . . . . . . . . . . . . . . . . . 105 5.5.2 Droop . . . . . . . . . . . . . . . . . . . . . . . . . . . . 107 5.5.3 PolarizationandLightExtraction . . . . . . . . . . . . . . 108 5.5.4 3D-SemipolarLEDsonc-PlaneSapphire . . . . . . . . . . 109 5.5.5 State-of-the-Artof Non- andSemipolarBlue,Green, andWhiteLEDs . . . . . . . . . . . . . . . . . . . . . . . 109 5.5.6 TowardsYellowLEDsandBeyond . . . . . . . . . . . . . 111 5.6 SummaryandOutlook . . . . . . . . . . . . . . . . . . . . . . . . 112 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 113 6 ActiveRegionPartA.InternalQuantumEfficiencyinLEDs . . . . . 121 ElisonMatioliandClaudeWeisbuch 6.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 122 6.2 AssessmentofIQEfromPhotoluminescenceMeasurements . . . . 123 6.3 Principle of IQE Assessment from Electroluminescence Measurements . . . . . . . . . . . . . . . . . . . . . . . . . . . . 125 6.3.1 CalculationofLightExtractionEfficiencyinaSimple GaN-BasedLED . . . . . . . . . . . . . . . . . . . . . . . 128 6.3.2 ApplicationtoLEDsGrownonBulkGaNSubstrates, ComplexLEDStructuresandLasers . . . . . . . . . . . . 130 6.4 ExperimentalAssessmentofIQE . . . . . . . . . . . . . . . . . . 131 6.4.1 IQEMeasurementofaState-of-the-ArtLED . . . . . . . . 132 6.4.2 EL-BasedIQEMeasurementofaPoorPerformingLED: EffectofSurfaceRoughness. . . . . . . . . . . . . . . . . 134 6.5 ModelforPhotonRecycling . . . . . . . . . . . . . . . . . . . . . 136 6.6 Conclusions . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 137