ebook img

Visual Texture: Accurate Material Appearance Measurement, Representation and Modeling PDF

304 Pages·2013·7.15 MB·English
Save to my drive
Quick download
Download
Most books are stored in the elastic cloud where traffic is expensive. For this reason, we have a limit on daily download.

Preview Visual Texture: Accurate Material Appearance Measurement, Representation and Modeling

Advances in Computer Vision and Pattern Recognition Forfurthervolumes: www.springer.com/series/4205 Michal Haindl (cid:2) Jiˇrí Filip Visual Texture Accurate Material Appearance Measurement, Representation and Modeling MichalHaindl JiˇríFilip Inst.ofInformationTheory&Automation Inst.ofInformationTheory&Automation Acad.ofSciencesoftheCzechRepublic Acad.ofSciencesoftheCzechRepublic Prague,CzechRepublic Prague,CzechRepublic SeriesEditors Prof.SameerSingh Dr.SingBingKang ResearchSchoolofInformatics MicrosoftResearch LoughboroughUniversity MicrosoftCorporation Loughborough Redmond,WA UK USA ISSN2191-6586 ISSN2191-6594(electronic) AdvancesinComputerVisionandPatternRecognition ISBN978-1-4471-4901-9 ISBN978-1-4471-4902-6(eBook) DOI10.1007/978-1-4471-4902-6 SpringerLondonHeidelbergNewYorkDordrecht LibraryofCongressControlNumber:2013930058 ©Springer-VerlagLondon2013 Thisworkissubjecttocopyright.AllrightsarereservedbythePublisher,whetherthewholeorpartof thematerialisconcerned,specificallytherightsoftranslation,reprinting,reuseofillustrations,recitation, broadcasting,reproductiononmicrofilmsorinanyotherphysicalway,andtransmissionorinformation storageandretrieval,electronicadaptation,computersoftware,orbysimilarordissimilarmethodology nowknownorhereafterdeveloped.Exemptedfromthislegalreservationarebriefexcerptsinconnection with reviews or scholarly analysis or material supplied specifically for the purpose of being entered and executed on a computer system, for exclusive use by the purchaser of the work. Duplication of this publication or parts thereof is permitted only under the provisions of the Copyright Law of the Publisher’slocation,initscurrentversion,andpermissionforusemustalwaysbeobtainedfromSpringer. PermissionsforusemaybeobtainedthroughRightsLinkattheCopyrightClearanceCenter.Violations areliabletoprosecutionundertherespectiveCopyrightLaw. Theuseofgeneraldescriptivenames,registerednames,trademarks,servicemarks,etc.inthispublication doesnotimply,evenintheabsenceofaspecificstatement,thatsuchnamesareexemptfromtherelevant protectivelawsandregulationsandthereforefreeforgeneraluse. Whiletheadviceandinformationinthisbookarebelievedtobetrueandaccurateatthedateofpub- lication,neithertheauthorsnortheeditorsnorthepublishercanacceptanylegalresponsibilityforany errorsoromissionsthatmaybemade.Thepublishermakesnowarranty,expressorimplied,withrespect tothematerialcontainedherein. Printedonacid-freepaper SpringerispartofSpringerScience+BusinessMedia(www.springer.com) To ourfamilies,fortheircontinuoussupport Preface Themainpurposeofthisbookistoprovideacomprehensivestate-of-the-artsurvey of the newly emerging area of physically correct visual texture modeling. Multi- dimensional visual texture is the appropriate paradigm for physically correct rep- resentation of material visual properties. The book presents recent advance in the texture modeling methodologyused in computer vision, pattern recognition, com- putergraphics,andvirtualandaugmentedrealityapplications. Whiletextureanalysisisawell-establishedresearchfield,itisstillpredominantly restrictedtothesimplestandmostapproximatetexturerepresentation—eithergray- scaleorcolortextures.Severalbooksdevotedtosuchsimplestatictextureanalysis havebeenpublished,butthereisnobookdedicatedtoeithertheareaofmoregeneral texturemodelingorrecentstate-of-the-arttexturalrepresentations. Severalfeaturessetourbookapartfromthefewothervisualtexturebookspub- lished. • Theonlybookwithcomprehensivetreatmentoftexturesynthesis. • The only book covering all known aspects of the most advanced visual surface representationwhichcanberecentlyapplied—theBidirectionalTextureFunction (BTF). • Therighttiming.Thisbookarrivesatatimeofadvancedcomputingandgraph- icshardwarewhichcanprocessandstoreenormousamountsofdataneededfor physicallycorrectmaterialmodelingandrecognition;likewise,recentGPUpro- grammingprogressallowsuserstoutilizerelativelyintuitiveandeconomicalpro- gramming.This allows for fast implementation,therebyenablingreal industrial applicationsofthepresentedmethods. • A complete reference. This self-contained book covers the entire pipeline from materialappearancerepresentation,measurement,analysis,andcompression,to modeling,editing,visualization,andperceptualevaluation. Recent progress in computing and acquisition technology of advanced visual data,togetherwithadvancesintheoriesofmathematicalmodeling,provideuswith timelyopportunitytoachievenewbreakthroughsbeyondthecurrentstateofcom- putervisionart.Finally,itispossibletomeasurenotonlytheordinarystaticcolor vii viii Preface textures, but also the far more complicated and accurate high-dimensional visual texturerepresentations. Naturalvisualtexturesprovideampleinformationaboutlocallightingfieldstruc- ture as well as the surface relief, accounting for such effects as self-occlusions, self-shadowing,inter-reflectionorsubsurfacescattering.Moreover,theappearance ofrealmaterialsdramaticallychangeswith,forexample,illuminationandviewing variations.Theprevailingcomputervisionmethodologyusesonlyasmallfraction ofthisreadilyavailableandpotentiallyrichinformationsource,butwebelievethat thisemergingresearchareawillsoonhavesignificantimpactsonfurtherprogressin artificialvisualcognitionandrelatedapplications.Ouraimisthustoofferthefirst bookwiththisfocus,inordertofosterthisdevelopment. The book builds on the authors’ work in this field over two decades and was inspiredbypositivefeedbacktoseveralofourtutorials:BidirectionalTextureFunc- tionModellingatCVPR2010,SanFrancisco,AccurateMaterialAppearanceMod- ellingatSCIA2011,Ystad,AdvancedTexturalRepresentationofMaterialsAppear- anceatSIGGRAPH2011,HongKong,andAdvancedNatureExteriorsModelling atICPR2012,Tsukuba. The book starts from the basic principles and builds on the fundamentals and basicvisualtexturetaxonomyintroducedasafoundationforusingthelatesttech- niquesintexturemodeling.Thereaderisexpectedtopossessgraduatelevelknowl- edge in statistics and probability theory as well as competence in basic computer graphicsprinciples.However,itisalsosuitablefornewcomerstothefieldofcom- puter graphics and computer vision, as well as for practitioners who wish to be brought up to date on the state-of-the-art methodology of texture modeling. This surveybookwillprovideausefulreferenceandtextbookforresearchers,lecturers, industrypractitioners,andstudentsinterestedinthisnewandprogressiveresearch area. We tried to keep the book as concise as possible to maintain its scope at an acceptable level. Rather than explaining mathematical and implementation details of all methods, we refer to the original publications. Our ambition was to provide the reader with general knowledge about state-of-the-art visual texture modeling. Attempting to rigorously explain, for example, the Markovian or mixture models usedinthisbookwouldrequireatleasttwiceasmanypages. Prague,CzechRepublic MichalHaindl JiˇríFilip Acknowledgements ManycolleaguesfromthedepartmentofPatternRecognitionoftheInstituteofIn- formationTheoryandAutomationoftheAcademyofSciencesoftheCzechRepub- licinPraguehavecontributedinvaluablepartstothisworkinourjointpublications or doing some experimental work. We would like to thank Dr. Jiˇrí Grim, Martin Hatka,MichalHavlícˇek,Dr.VojteˇchHavlícˇek,RadekHolub,Dr.StanislavMikeš, VáclavRemeš,Dr.PetrSomol,Dr.PavelVácha,RadomírVávra,andDr.PavelŽid. We are also grateful for many stimulating discussions to colleagues—Prof. MichaelJ. Chantler,Prof.PatrickR.Greenfrom theHeriot-WattUniversity,Prof. ReinhardKleinfromtheBonnUniversity,Dr.GiuseppeScarpafromtheUniversity FedericoII,andProf.MineichiKudofromtheHokkaidoUniversity. WewouldlikealsotothankBonnUniversityandYaleUniversityforproviding ussomeBTFmeasurementsusedinthisbook,DaimlerChryslerAGfor3Dmodelof carinterior,variousparticipantsfortakingpartinthepsycho-physicalexperiments, andforthepartialsupportoftheCzechScienceFoundationprojects102/08/0593, 103/11/0335. Finally,wewouldliketothankourfamiliesfortheirsupportandpatienceduring manyyearsofresearchleadingtothisbook. ix Contents 1 Motivation. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1 1.1 VisualTextureDefinition . . . . . . . . . . . . . . . . . . . . . . 1 1.2 ContentsOverview. . . . . . . . . . . . . . . . . . . . . . . . . . 6 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 7 2 Representation . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9 2.1 GeneralReflectanceFunction . . . . . . . . . . . . . . . . . . . . 9 2.2 TexturedModelRepresentationTaxonomy . . . . . . . . . . . . . 12 2.2.1 BidirectionalSurfaceScatteringReflectanceDistribution Function . . . . . . . . . . . . . . . . . . . . . . . . . . . 12 2.2.2 Bidirectional Reflectance and Transmittance Texture Function . . . . . . . . . . . . . . . . . . . . . . . . . . . 13 2.2.3 BidirectionalTextureFunction . . . . . . . . . . . . . . . 14 2.2.4 SpatiallyVaryingBRDF . . . . . . . . . . . . . . . . . . . 14 2.2.5 SurfaceLightField . . . . . . . . . . . . . . . . . . . . . 15 2.2.6 SurfaceReflectanceField . . . . . . . . . . . . . . . . . . 16 2.2.7 MultispectralTexture . . . . . . . . . . . . . . . . . . . . 16 2.3 RepresentationTaxonomyofHomogeneousModels . . . . . . . . 17 2.3.1 BidirectionalScatteringDistributionFunction . . . . . . . 18 2.3.2 BidirectionalReflectanceDistributionFunction . . . . . . 18 2.3.3 BidirectionalTransmittanceDistributionFunction . . . . . 19 2.3.4 Isotropic Bidirectional Reflectance Distribution Function . . . . . . . . . . . . . . . . . . . . . . . . . . . 20 2.4 AttributesofTaxonomicalClasses . . . . . . . . . . . . . . . . . 21 2.4.1 TaxonomicalClassAdvantages . . . . . . . . . . . . . . . 21 2.4.2 TaxonomicalClassDrawbacks . . . . . . . . . . . . . . . 22 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 22 3 TextureAcquisition . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23 3.1 HighDynamicRangeTextureAcquisition . . . . . . . . . . . . . 23 3.2 StaticTexturesAcquisition . . . . . . . . . . . . . . . . . . . . . 24 xi xii Contents 3.3 DynamicTexturesAcquisition. . . . . . . . . . . . . . . . . . . . 25 3.4 BRDFAcquisition . . . . . . . . . . . . . . . . . . . . . . . . . . 26 3.4.1 Gonioreflectometers-BasedBRDFSetups . . . . . . . . . 28 3.4.2 Mirror-BasedBRDFSetups . . . . . . . . . . . . . . . . . 30 3.4.3 Image-BasedBRDFAcquisition . . . . . . . . . . . . . . 32 3.4.4 PortableBRDFAcquisitionSystems . . . . . . . . . . . . 34 3.5 SpatiallyVaryingBRDFAcquisition . . . . . . . . . . . . . . . . 35 3.6 BTFAcquisition . . . . . . . . . . . . . . . . . . . . . . . . . . . 37 3.6.1 Gonioreflectometers-BasedBTFSetups. . . . . . . . . . . 38 3.6.2 Mirror-BasedBTFSetups . . . . . . . . . . . . . . . . . . 42 3.6.3 OtherBTFSetups . . . . . . . . . . . . . . . . . . . . . . 42 3.6.4 SparseSamplingofBTF. . . . . . . . . . . . . . . . . . . 43 3.6.5 BTFSetupsOverview . . . . . . . . . . . . . . . . . . . . 44 3.6.6 ABTFSetupDesign. . . . . . . . . . . . . . . . . . . . . 44 3.7 MeasurementofTime-VaryingSurfaces . . . . . . . . . . . . . . 47 3.8 BSSRDFMeasurement . . . . . . . . . . . . . . . . . . . . . . . 48 3.8.1 Diffuse-Specular Separation of Reflectance Measurements . . . . . . . . . . . . . . . . . . . . . . . . 48 3.8.2 HomogeneousSubsurfaceScatteringMeasurement . . . . 50 3.8.3 SpatiallyVaryingSubsurfaceScatteringMeasurement . . . 51 3.9 SurfaceLightandReflectanceFieldsMeasurements . . . . . . . . 53 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 55 4 StaticMultispectralTextures . . . . . . . . . . . . . . . . . . . . . . 63 4.1 TextureModelingApproaches . . . . . . . . . . . . . . . . . . . . 63 4.2 Model-BasedRepresentations . . . . . . . . . . . . . . . . . . . . 64 4.2.1 SpectralFactorization . . . . . . . . . . . . . . . . . . . . 65 4.2.2 SpatialFactorization . . . . . . . . . . . . . . . . . . . . . 66 4.2.3 FractalModels . . . . . . . . . . . . . . . . . . . . . . . . 67 4.2.4 RandomMosaics . . . . . . . . . . . . . . . . . . . . . . 68 4.2.5 MarkovianModels . . . . . . . . . . . . . . . . . . . . . . 70 4.2.6 MixtureModels . . . . . . . . . . . . . . . . . . . . . . . 80 4.2.7 ProbabilisticDiscrete-Mixture2DModel . . . . . . . . . . 83 4.2.8 BernoulliDistributionMixtureModel. . . . . . . . . . . . 84 4.2.9 Gaussian-Mixture2DModel . . . . . . . . . . . . . . . . 85 4.2.10 MixtureModel-BasedTextureSynthesis . . . . . . . . . . 86 4.2.11 ProbabilisticMixtureModelsProperties . . . . . . . . . . 87 4.3 TextureSampling . . . . . . . . . . . . . . . . . . . . . . . . . . 88 4.3.1 TextureSamplingMethods . . . . . . . . . . . . . . . . . 88 4.3.2 Roller . . . . . . . . . . . . . . . . . . . . . . . . . . . . 89 4.3.3 SamplingMethodsSummary . . . . . . . . . . . . . . . . 89 4.4 HybridModeling. . . . . . . . . . . . . . . . . . . . . . . . . . . 90 References . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 92 5 DynamicTextures . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 5.1 Introduction . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97

Description:
This book surveys the state of the art in multidimensional, physically-correct visual texture modeling. Features: reviews the entire process of texture synthesis, including material appearance representation, measurement, analysis, compression, modeling, editing, visualization, and perceptual evalua
See more

The list of books you might like

Most books are stored in the elastic cloud where traffic is expensive. For this reason, we have a limit on daily download.