Semiconductors New Data and Updates for IIa-VI Compounds with Mg and Sr (Structural Properties, Thermal and Thermodynamic Properties, and Lattice Properties) PDF
Preview Semiconductors New Data and Updates for IIa-VI Compounds with Mg and Sr (Structural Properties, Thermal and Thermodynamic Properties, and Lattice Properties)
New Series Numerical Data and Functional Relationships in Science and Technology GROUP III VOLUME 44 Condensed Semiconductors Matter SUBVOLUME H New Data and Updates for IIa-VI Compounds with Mg and Sr (Structural Properties, Th ermal and Th ermo- dynamic Properties, and Lattice Properties) 123 MATERIALS.SPRINGER.COM € Landolt-Bornstein: Numerical Data and Functional Relationships in Science and Technology - New Series Group III: Condensed Matter Volume 44H Landolt-Bo¨rnstein Numerical Data and Functional Relationships in Science and Technology New Series Units and Fundamental Constants in Physics and Chemistry Elementary Particles, Nuclei and Atoms (Group I) (Formerly:NuclearandParticlePhysics) Molecules and Radicals (Group II) (Formerly:AtomicandMolecularPhysics) Condensed Matter (Group III) (Formerly:SolidStatePhysics) Physical Chemistry (Group IV) (Formerly:MacroscopicPropertiesofMatter) Geophysics (Group V) Astronomy and Astrophysics (Group VI) Biophysics (Group VII) Advanced Materials and Technologies (Group VIII) Someofthegroupnameshavebeenchangedtoprovideabetterdescriptionoftheircontents. € Ulrich Rossler Editor Semiconductors Subvolume H New Data and Updates for IIa-VI Compounds with Mg and Sr (Structural Properties, Thermal and Thermodynamic Properties, and Lattice Properties) Dieter Strauch Author Editor UlrichR€ossler InstituteforTheoreticalPhysics UniversityofRegensburg Regensburg,Germany Author DieterStrauch InstituteforTheoreticalPhysics UniversityofRegensburg Regensburg,Germany ISSN1615-1925 ISSN1616-9549(electronic) ISBN978-3-662-53618-6 ISBN978-3-662-53620-9(eBook) DOI10.1007/978-3-662-53620-9 LibraryofCongressControlNumber:2017930684 ©Springer-VerlagGmbHGermany2017 Thisworkissubjecttocopyright.AllrightsarereservedbythePublisher,whetherthewholeorpartofthematerialisconcerned, specificallytherightsoftranslation,reprinting,reuseofillustrations,recitation,broadcasting,reproductiononmicrofilmsorinany otherphysicalway,andtransmissionorinformationstorageandretrieval,electronicadaptation,computersoftware,orbysimilaror dissimilarmethodologynowknownorhereafterdeveloped. Theuseofgeneraldescriptivenames,registerednames,trademarks,servicemarks,etc.inthispublicationdoesnotimply,eveninthe absenceofaspecificstatement,thatsuchnamesareexemptfromtherelevantprotectivelawsandregulationsandthereforefreefor generaluse. Thepublisher,theauthorsandtheeditorsaresafetoassumethattheadviceandinformationinthisbookarebelievedtobetrueand accurateatthedateofpublication.Neitherthepublishernortheauthorsortheeditorsgiveawarranty,expressorimplied,withrespect tothematerialcontainedhereinorforanyerrorsoromissionsthatmayhavebeenmade.Thepublisherremainsneutralwithregardto jurisdictionalclaimsinpublishedmapsandinstitutionalaffiliations. Printedonacid-freepaper ThisSpringerimprintispublishedbySpringerNature TheregisteredcompanyisSpringer-VerlagGmbHGermany Theregisteredcompanyaddressis:HeidelbergerPlatz3,14197Berlin,Germany Preface of the Editor ThelastupdateoftheLandolt-B€ornsteinNewSeriesonsemiconductorphysicsandtechnology,consisting ofthefivesubvolumesIII/41AtoIII/41E,waspublishedintheyearsbetween1998and2002.Insteadofa revised edition of the original volumes III/17A to III/17I (published between 1982 and 1985) and their supplementsIII/22AandIII/22B(publishedbetween1987and1989)oranewsupplement,thislastupdate followedanewconceptofprovidingaCD-ROMofeachsubvolumewithallupdatesandarevisedversion of the corresponding old data besides the printed version of the new data. Thus, all collected data were madeavailabletotheuserinaverycompactandconsistentform. In the more than 7 years since this last update, semiconductor research has brought forth new data of standard semiconductors, and, even more, data on a variety of new materials, which became of techno- logicalinterest,havebeenpublished.Inthemeantime,thepublisherhaddecidedtodeveloptheLandolt- B€ornsteindatacollectionintoanelectronicmajorreferencework.Therefore,Springerdecidedin2005to startanewupdateprojectwiththeintentiontocompletetheonlinedatabaseinshorterintervals.Thefirst input, containing data on semiconductors with tetrahedral coordination of the I–VII, II–VI, and III–V compoundsaswellasofIII–VIandIV–VIsemiconductors,wentonlinein2008.Thesedataaremeanwhile available on materials.springer.com, a broad platform on materials information that fully incorporates Landolt-B€ornstein. Modern navigation and search functionalities offer different ways of access to the content.Auserguidehelpsthereaderinfindingtherelevantinformationtohisneeds.Thefirstsubvolume III/44Astartswith“SystematicsofSemiconductorProperties,”whichshouldhelpthenonspecialistuserto understandthemeaningofthematerialparameters.Allthevolumesarealsoavailableinprintedform. SubvolumeIII/44A:NewDataandUpdatesforI–VII,III–V,III–VIandIV–VICompounds SubvolumeIII/44B:NewDataandUpdatesforII–VICompounds SubvolumeIII/44C:NewDataandUpdatesforIII–V,II–VIandI–VIICompounds Subvolume III/44D: New Data and Updates for IV–IV, III–V, II–VI, I–VII Compounds, their mixed crystalsanddilutedmagneticsemiconductors Subvolume III/44E: New Data and Updates for several III–V (including mixed crystals) and II–VI Compounds SubvolumeIII/44F:NewDataandUpdatesforseveralSemiconductorswithChalcopyriteStructure,for severalII–VICompoundsanddilutedmagneticIV–VICompounds. Thelastsubvolumeinthisseries Subvolume III/44G: New Data and Updates for several IIa–VI Compounds (Structural Properties, ThermalandThermodynamicProperties,andLatticeProperties) containedthementionedmaterialpropertiesnotofallIIa–VIcompoundsbutonlythosewithBa,Be,and Ca.ThecorrespondingpropertiesofcompoundswithMgandSrarenowpresentedin SubvolumeIII/44H:NewDataandUpdatesforIIa–VICompoundswithMgandSr(StructuralProperties, ThermalandThermodynamicProperties,andLatticeProperties) Thedatapresentedinthissubvolumehadbeencollectedalreadytogetherwiththoseofsubvolume44H in2014,but(duetodecisionsofthepublisher)cometopublicationonlynow. Alsothissubvolumecouldbeaccomplishedonlywiththediligenceandpatienceoftheauthors,whose efforts and expertise have to be acknowledged in the first place. Every single page and document had to pass the control of Martin Müller of the Landolt-B€ornstein editorial office. His efforts in managing and accompanyingthepublicationprocesshavebeenessentialfortheprogressinthisupdateproject. Regensburg TheEditor August2016 v Contents SystematicsofSemiconductorProperties .................................. seeLBIII/44A IndexofSubstances ................................................... seeLBIII/44A ListofSymbols ...................................................... seeLBIII/44A ConversionFactors ................................................... seeLBIII/44A MgO:RadialDistributionFunction,CoordinationNumber. . . . . . . . . . . . . . . . . . . . . . . . . . . 1 MgO:PhaseTransitionTemperature,PhaseDiagram,TransitionPath, FerroelectricPhaseTransition,MetallizationTransition. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3 MgO:EquationofState. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9 MgO:MeltingCurve,MeltingTemperature. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 13 MgO:ThermalConductivity. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 MgO:ThermalExpansion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 19 MgO:PhononDispersionCurves,PhononDensityofStates. . . . . . . . . . . . . . . . . . . . . . . . . . 23 MgO:InfraredPhononSpectra. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 29 MgO:PhononFrequencies,PhononLineWidths,Mode-Gru€neisenParameters,Surface PhononFrequencies. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31 MgO:ElasticConstants,SoundVelocities,UltrasoundAttenuation,InternalStrain Parameter. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35 MgO:BulkandShearModuli. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 45 MgO:DielectricConstant,BornEffectiveCharge. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 57 MgS:ThermalExpansion. .. . . . .. . . . .. . . . . .. . . . .. . . . .. . . . .. . . . .. . . . .. . . . .. . . . . 61 MgS:PhononDispersionRelations,PhononDensityofStates. . . . . . . . . . . . . . . . . . . . . . . . . 63 Mgs:ElasticConstants. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 67 MgSe:LatticeParameters. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 71 MgSe:PhononDispersionRelations,PhononDensityofStates. . . . . . . . . . . . . . . . . . . . . . . . 75 MgSe:ElasticConstants. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 79 MgTe:PhaseTransitionPressure,PhaseStability,EquationofState. . . . . . . . . . . . . . . . . . . 83 MgTe:Enthalpy. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 85 MgTe:PhononDispersionRelations,DensityofPhononStates. . . . . . . . . . . . . . . . . . . . . . . . 87 MgTe:PhononFrequencies. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 93 SrO:PhaseTransitionPressure,PhaseStability,PhaseDiagram. . . . . . . . . . . . . . . . . . . . . . 95 SrO:ThermalExpansion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 vii viii Contents SrO:PhononDispersionRelations,PhononDensityofStates. . . . . . . . . . . . . . . . . . . . . . . . . 99 SrO:PhononFrequencies,Mode-Gru€neisenParameters. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 103 SrO:DielectricConstant,BornEffectiveCharge. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 107 SrS:PhaseTransitionPressure,PhaseTransitionTemperature. . . . . . . . . . . . . . . . . . . . . . . 111 SrS:ThermalExpansion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 113 SrS:PhononDispersionRelations,PhononDensityofStates. . . . . . . . . . . . . . . . . . . . . . . . . . 115 SrS:PhononFrequencies. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 117 SrS:BulkModulus. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 119 SrS:DielectricConstant. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 123 SrSe:PhaseTransitionPressure. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 125 SrSe:ThermalExpansion. . . . .. . . . . .. . . . .. . . . .. . . . .. . . . .. . . . .. . . . .. . . . .. . . . . .. 127 SrSe:PhononDispersionRelations,PhononDensityofStates. . . . . . . . . . . . . . . . . . . . . . . . . 129 SrSe:BulkModulus. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 131 SrSe:DielectricConstant. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 135 SrTe:PhaseTransitionPressure,PhaseStability. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 137 SrTe:ThermalExpansion. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 139 SrTe:PhononDispersionRelations,PhononDensityofStates. . . . . . . . . . . . . . . . . . . . . . . . . 141 SrTe:ElasticConstants. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 143 SrTe:BulkModulus. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 147 SrTe:DielectricConstant. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 151 MgO: Radial Distribution Function, Coordination Number Substance: Magnesiumoxide(MgO) Property: Radialdistributionfunction,coordination(structuralproperties) RadialDistributionFunction For the radial distribution functions of liquid (and solid) MgO at three different points on the melting curvefrommolecular-dynamicssimulationsusingforceconstantsfromDFT-LDAcalculationsseeFig.1 [06K]. a b Fig.1 MgO.Radialdistributionfunctionsofliquid(andsolid)MgOforthreedifferentpointsalongthemeltingcurvefrom molecular-dynamicssimulationsusingforceconstantsfromDFT-LDAcalculations[06K] Fig.2 MgO.Coordination numberofliquid(andsolid) MgOasafunctionof compressionfrom molecular-dynamics simulationsusingforce constantsfromDFT-LDA calculations[06K] ©Springer-VerlagGmbHGermany2017 1 U.R€ossler,Semiconductors, DOI10.1007/978-3-662-53620-9_1 2 MgO:RadialDistributionFunction,CoordinationNumber CoordinationNumber For the coordination number of liquid MgO as a function of compression from molecular-dynamics simulationsusingforceconstantsfromDFT-LDAcalculationsseeFig.2[06K]. References [06K]Karki,B.B.,Bhattarai,D.,Stixrude,L.:Phys.Rev.73(2006)174208.
The list of books you might like
